* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,7-DICHLORO-3-IODO-1H-INDAZOLE |
CAS: | 885271-35-2 |
English Synonyms: | 1H-INDAZOLE, 5,7-DICHLORO-3-IODO- ; 5,7-DICHLORO-3-IODO-1H-INDAZOLE |
MDL Number.: | MFCD06796158 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c2c1c(n[nH]2)I)Cl)Cl |
InChi: | InChI=1S/C7H3Cl2IN2/c8-3-1-4-6(5(9)2-3)11-12-7(4)10/h1-2H,(H,11,12) |
InChiKey: | InChIKey=PANBUJPQIXLTTG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.