* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ARNOTTININ |
CAS: | 53004-79-8 |
English Synonyms: | ARNOTTININ |
MDL Number.: | MFCD06796681 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C/C(=C/Cc1c(ccc2c1oc(=O)cc2)O)/CO |
InChi: | InChI=1S/C14H14O4/c1-9(8-15)2-5-11-12(16)6-3-10-4-7-13(17)18-14(10)11/h2-4,6-7,15-16H,5,8H2,1H3/b9-2- |
InChiKey: | InChIKey=TXAQUMCUNALGRP-MBXJOHMKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.