* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINUCLIDINE-3,5-DIOL |
| English Synonyms: | QUINUCLIDINE-3,5-DIOL |
| MDL Number.: | MFCD06798961 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1CN2CC([C@H]1C(C2)O)O |
| InChi: | InChI=1S/C7H13NO2/c9-6-3-8-2-1-5(6)7(10)4-8/h5-7,9-10H,1-4H2 |
| InChiKey: | InChIKey=MUNFGPMOEQANQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.