* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-9H-BENZO[4,5]IMIDAZO[2,1-C][1,2,4]TRIAZOL-3-YLAMINE |
| English Synonyms: | 9-METHYL-9H-BENZO[4,5]IMIDAZO[2,1-C][1,2,4]TRIAZOL-3-YLAMINE |
| MDL Number.: | MFCD06799541 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cn1c2ccccc2n3c1nnc3N |
| InChi: | InChI=1S/C9H9N5/c1-13-6-4-2-3-5-7(6)14-8(10)11-12-9(13)14/h2-5H,1H3,(H2,10,11) |
| InChiKey: | InChIKey=GTCGPEFBTHLDCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.