* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-9H-BENZO[4,5]IMIDAZO[2,1-C][1,2,4]TRIAZOLE |
| English Synonyms: | 9-METHYL-9H-BENZO[4,5]IMIDAZO[2,1-C][1,2,4]TRIAZOLE |
| MDL Number.: | MFCD06799550 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cn1c2ccccc2n3c1nnc3 |
| InChi: | InChI=1S/C9H8N4/c1-12-7-4-2-3-5-8(7)13-6-10-11-9(12)13/h2-6H,1H3 |
| InChiKey: | InChIKey=KAIOSMSLMGEYAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.