* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(4'-FLUORO[1,1'-BIPHENYL]-2-YL)ETHANONE |
| CAS: | 552885-75-3 |
| English Synonyms: | 1-(4'-FLUORO[1,1'-BIPHENYL]-2-YL)ETHANONE ; ETHANONE, 1-(4'-FLUORO[1,1'-BIPHENYL]-2-YL)- ; 1-[2-(4-FLUOROPHENYL)PHENYL]ETHAN-1-ONE |
| MDL Number.: | MFCD06802701 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=O)c1ccccc1c2ccc(cc2)F |
| InChi: | InChI=1S/C14H11FO/c1-10(16)13-4-2-3-5-14(13)11-6-8-12(15)9-7-11/h2-9H,1H3 |
| InChiKey: | InChIKey=ZMYUDBAVUSREBW-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.