* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMPERATORIN |
| CAS: | 148-83-4 |
| English Synonyms: | IMPERATORIN ; OSTRUTHIN |
| MDL Number.: | MFCD07771988 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(=CCC/C(=C/Cc1cc2ccc(=O)oc2cc1O)/C)C |
| InChi: | InChI=1S/C19H22O3/c1-13(2)5-4-6-14(3)7-8-15-11-16-9-10-19(21)22-18(16)12-17(15)20/h5,7,9-12,20H,4,6,8H2,1-3H3/b14-7+ |
| InChiKey: | InChIKey=INBMTJJPUABOQJ-VGOFMYFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.