* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITEXILACTONE |
CAS: | 61263-49-8 |
English Synonyms: | VITEXILACTONE |
MDL Number.: | MFCD07779142 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C[C@@H]1C[C@H]([C@H]2C(CCC[C@@]2([C@]1(CCC3=CC(=O)OC3)O)C)(C)C)OC(=O)C |
InChi: | InChI=1S/C22H34O5/c1-14-11-17(27-15(2)23)19-20(3,4)8-6-9-21(19,5)22(14,25)10-7-16-12-18(24)26-13-16/h12,14,17,19,25H,6-11,13H2,1-5H3/t14-,17-,19+,21+,22-/m1/s1 |
InChiKey: | InChIKey=FBWWXAGANVJTLU-HEXLTJKYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.