* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GANODERIC ACID A |
| CAS: | 81907-62-2 |
| English Synonyms: | GANODERIC ACID A |
| MDL Number.: | MFCD07779161 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(CC(=O)/C=C(\C)/[C@H]1C[C@@H]([C@@]2([C@@]1(CC(=O)C3=C2[C@H](C[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)O)C)C)O)C(=O)O |
| InChi: | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21,23,32,35H,8-9,11-14H2,1-7H3,(H,36,37)/b15-10+/t16?,18-,19+,21+,23+,28+,29-,30+/m1/s1 |
| InChiKey: | InChIKey=OVUOUFPIPZJGME-JQDIJSAQSA-N |
|
|
| Comments: | ASSAY BY HPLC |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.