* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUOROINOSINE |
| English Synonyms: | 8-FLUOROINOSINE |
| MDL Number.: | MFCD07779396 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1[nH]c(=O)c2c(n1)n(c(n2)F)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
| InChi: | InChI=1S/C10H11FN4O5/c11-10-14-4-7(12-2-13-8(4)19)15(10)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,12,13,19)/t3-,5-,6-,9-/m1/s1 |
| InChiKey: | InChIKey=WCCCJESBUQYNMK-UUOKFMHZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.