* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-BROMONONYL ACETATE |
| English Synonyms: | 9-BROMONONYL ACETATE |
| MDL Number.: | MFCD07780192 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=O)OCCCCCCCCCBr |
| InChi: | InChI=1S/C11H21BrO2/c1-11(13)14-10-8-6-4-2-3-5-7-9-12/h2-10H2,1H3 |
| InChiKey: | InChIKey=ZLUALHMNABZRAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.