* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-ETHOXY-5-IODOPYRIDINE |
CAS: | 902837-52-9 |
English Synonyms: | 2-ETHOXY-5-IODOPYRIDINE |
MDL Number.: | MFCD07781181 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOc1ccc(cn1)I |
InChi: | InChI=1S/C7H8INO/c1-2-10-7-4-3-6(8)5-9-7/h3-5H,2H2,1H3 |
InChiKey: | InChIKey=AIFZXWONOPNLLM-UHFFFAOYSA-N |
|
|
Comments: | HAZARD: R 36/37/38 HAZARD: S 26-37 IRRITANT UNSPSC: 12352005 |
|
* If the product has intellectual property rights, a license granted is must or contact us.