* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MAGNOLINE |
| CAS: | 6859-66-1 |
| English Synonyms: | MAGNOLINE |
| MDL Number.: | MFCD07781417 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CN1CCc2cc(c(cc2[C@@H]1Cc3ccc(cc3)Oc4cc(ccc4O)C[C@@H]5c6cc(c(cc6CCN5C)OC)O)O)OC |
| InChi: | InChI=1S/C36H40N2O6/c1-37-13-11-24-18-34(42-3)32(40)20-27(24)29(37)15-22-5-8-26(9-6-22)44-36-17-23(7-10-31(36)39)16-30-28-21-33(41)35(43-4)19-25(28)12-14-38(30)2/h5-10,17-21,29-30,39-41H,11-16H2,1-4H3/t29-,30+/m0/s1 |
| InChiKey: | InChIKey=FDABVSXGAMFQQH-XZWHSSHBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.