* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHOXY-10-(3-METHYL-BUT-2-ENYL)-6A,11A-DIHYDRO-6H-BENZO[4,5]FURO[3,2-C]CHROMEN-3-OL |
| English Synonyms: | 9-METHOXY-10-(3-METHYL-BUT-2-ENYL)-6A,11A-DIHYDRO-6H-BENZO[4,5]FURO[3,2-C]CHROMEN-3-OL |
| MDL Number.: | MFCD07782288 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(=CCc1c(ccc2c1OC3C2COc4c3ccc(c4)O)OC)C |
| InChi: | InChI=1S/C21H22O4/c1-12(2)4-6-15-18(23-3)9-8-14-17-11-24-19-10-13(22)5-7-16(19)21(17)25-20(14)15/h4-5,7-10,17,21-22H,6,11H2,1-3H3 |
| InChiKey: | InChIKey=ZFUZIYGRFSXEIQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.