* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | AMMONIUM VALERATE |
| CAS: | 42739-38-8 |
| English Synonyms: | AMMONIUM VALERATE |
| MDL Number.: | MFCD07783109 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCC(=O)O.N |
| InChi: | InChI=1S/C5H10O2.H3N/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);1H3 |
| InChiKey: | InChIKey=RXQNHIDQIJXKTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.