* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAPYRAMINE |
| CAS: | 20493-41-8 |
| English Synonyms: | QUINAPYRAMINE |
| MDL Number.: | MFCD07799968 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | Cc1cc(c2cc(ccc2[n+]1C)Nc3cc([n+](c(n3)N)C)C)N |
| InChi: | InChI=1S/C17H20N6/c1-10-7-14(18)13-9-12(5-6-15(13)22(10)3)20-16-8-11(2)23(4)17(19)21-16/h5-9,18H,1-4H3,(H2,19,20,21)/p+2 |
| InChiKey: | InChIKey=KMJWBVJQFGRCEB-UHFFFAOYSA-P |
* If the product has intellectual property rights, a license granted is must or contact us.