* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYOXYLIC ACID, [1-14C] SODIUM SALT |
| English Synonyms: | GLYOXYLIC ACID, [1-14C] SODIUM SALT |
| MDL Number.: | MFCD08061737 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | C(=O)[14C](=O)[O-].[Na+] |
| InChi: | InChI=1S/C2H2O3.Na/c3-1-2(4)5;/h1H,(H,4,5);/q;+1/p-1/i2+2; |
| InChiKey: | InChIKey=SOEVVANXSDKPIY-UOEUYCPOSA-M |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.