* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VENTURICIDIN B |
| CAS: | 33538-72-6 |
| English Synonyms: | VENTURICIDIN B |
| MDL Number.: | MFCD08061904 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CCC(=O)[C@@H](C)[C@H]([C@H](C)C[C@@H](C)[C@@H]1[C@@H](C[C@H](/C=C/[C@@H](CCC/C=C(/[C@@H]2C(=CC[C@@](O2)(CC(=O)O1)O)C)\C)O[C@H]3C[C@H]([C@@H]([C@H](O3)C)O)O)C)C)O |
| InChi: | InChI=1S/C40H66O10/c1-10-32(41)29(8)36(44)26(5)20-28(7)38-27(6)19-23(2)15-16-31(48-35-21-33(42)37(45)30(9)47-35)14-12-11-13-24(3)39-25(4)17-18-40(46,50-39)22-34(43)49-38/h13,15-17,23,26-31,33,35-39,42,44-46H,10-12,14,18-22H2,1-9H3/b16-15+,24-13+/t23-,26+,27+,28+,29+,30+,31+,33+,35-,36-,37+,38-,39+,40+/m0/s1 |
| InChiKey: | InChIKey=VIOYQVOQUWWSAB-KEXSXYLYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.