* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7ALPHA-METHYL-3,3-DIMETHOXY-5(10)-ESTRENE-17-ONE |
| CAS: | 88247-84-1 |
| English Synonyms: | (7ALPHA)-3,3-DIMETHOXY-7-METHYLESTR-5(10)-EN-17-ONE ; ESTR-5(10)-EN-17-ONE, 3,3-DIMETHOXY-7-METHYL-, (7A)- ; 7ALPHA-METHYL-3,3-DIMETHOXY-5(10)-ESTRENE-17-ONE ; 7A-METHYL-3,3-DIMETHOXY-5(10)-ESTRENE-17-ONE |
| MDL Number.: | MFCD08063855 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | C[C@@H]1CC2=C(CCC(C2)(OC)OC)[C@@H]3[C@@H]1[C@@H]4CCC(=O)[C@]4(CC3)C |
| InChi: | InChI=1S/C21H32O3/c1-13-11-14-12-21(23-3,24-4)10-8-15(14)16-7-9-20(2)17(19(13)16)5-6-18(20)22/h13,16-17,19H,5-12H2,1-4H3/t13-,16-,17+,19-,20+/m1/s1 |
| InChiKey: | InChIKey=RKALVZFWSBYRNC-HIHRSEIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.