* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRIDO[2,3-D]PYRIMIDIN-4(1H)-ONE |
CAS: | 24410-19-3 |
English Synonyms: | PYRIDO[2,3-D]PYRIMIDIN-4(1H)-ONE ; PYRIDO[2,3-D]PYRIMIDIN-4(3H)-ONE |
MDL Number.: | MFCD08234707 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c([nH]cnc2=O)nc1 |
InChi: | InChI=1S/C7H5N3O/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-4H,(H,8,9,10,11) |
InChiKey: | InChIKey=XKEBMWRWBWRQAO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.