* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CYCLOBUTYL-1,3,4-THIADIAZOL-2-AMINE |
| CAS: | 56882-73-6 |
| English Synonyms: | 5-CYCLOBUTYL-1,3,4-THIADIAZOL-2-AMINE |
| MDL Number.: | MFCD08236300 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C1CC(C1)c2nnc(s2)N |
| InChi: | InChI=1S/C6H9N3S/c7-6-9-8-5(10-6)4-2-1-3-4/h4H,1-3H2,(H2,7,9) |
| InChiKey: | InChIKey=ROBHTWLKDVLHNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.