* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE |
| CAS: | 94220-38-9 |
| English Synonyms: | 7-CHLORO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE ; ABLOCK AB-10-6291 ; ABBYPHARMA AP-11-10112 |
| MDL Number.: | MFCD08236755 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(c2c(n1)cn[nH]2)Cl |
| InChi: | InChI=1S/C7H6ClN3/c1-4-2-5(8)7-6(10-4)3-9-11-7/h2-3H,1H3,(H,9,11) |
| InChiKey: | InChIKey=GTYZRPHAMFVUEE-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.