* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-AZASPIRO[4.5]DECANE |
CAS: | 176-64-7 ;1123-30-4 |
English Synonyms: | 8-AZA-SPIRO[4.5]DECANE ; 8-AZASPIRO[4.5]DECANE |
MDL Number.: | MFCD08361562 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1CCC2(C1)CCNCC2 |
InChi: | InChI=1S/C9H17N/c1-2-4-9(3-1)5-7-10-8-6-9/h10H,1-8H2 |
InChiKey: | InChIKey=AXMNGEUJXLXFRY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.