* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KA 0495 |
English Synonyms: | RARECHEM AN KA 0495 |
MDL Number.: | MFCD08448979 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1c(c(c(n1)C(F)(F)F)CCN)SCc2ccccc2Cl |
InChi: | InChI=1S/C14H15ClF3N3S/c1-21-13(22-8-9-4-2-3-5-11(9)15)10(6-7-19)12(20-21)14(16,17)18/h2-5H,6-8,19H2,1H3 |
InChiKey: | InChIKey=LQYOOXMDZINKTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.