* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KA 1478 |
English Synonyms: | RARECHEM AN KA 1478 |
MDL Number.: | MFCD08449697 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1ccccc1c2ccccc2CCN |
InChi: | InChI=1S/C15H17N/c1-12-6-2-4-8-14(12)15-9-5-3-7-13(15)10-11-16/h2-9H,10-11,16H2,1H3 |
InChiKey: | InChIKey=ASXOAWOPNYERBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.