* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KA 2239 |
English Synonyms: | RARECHEM AN KA 2239 |
MDL Number.: | MFCD08450404 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc(ccc1c2c(c[nH]n2)CCN)O |
InChi: | InChI=1S/C11H13N3O/c12-6-5-9-7-13-14-11(9)8-1-3-10(15)4-2-8/h1-4,7,15H,5-6,12H2,(H,13,14) |
InChiKey: | InChIKey=YOBKMPXFNJJTCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.