* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KB 0696 |
English Synonyms: | RARECHEM AN KB 0696 |
MDL Number.: | MFCD08451098 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(Cc1ccc(nc1)Oc2cccc(c2)C(F)(F)F)N |
InChi: | InChI=1S/C16H17F3N2O/c1-2-13(20)8-11-6-7-15(21-10-11)22-14-5-3-4-12(9-14)16(17,18)19/h3-7,9-10,13H,2,8,20H2,1H3 |
InChiKey: | InChIKey=XPAVBAQFJKRYFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.