* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KB 0697 |
English Synonyms: | RARECHEM AN KB 0697 |
MDL Number.: | MFCD08451099 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(Cc1c(nn(c1Sc2ccc(cc2)C(C)(C)C)C)c3ccccc3)N |
InChi: | InChI=1S/C24H31N3S/c1-6-19(25)16-21-22(17-10-8-7-9-11-17)26-27(5)23(21)28-20-14-12-18(13-15-20)24(2,3)4/h7-15,19H,6,16,25H2,1-5H3 |
InChiKey: | InChIKey=RCSCLBQOEGIFEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.