* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KB 0709 |
English Synonyms: | RARECHEM AN KB 0709 |
MDL Number.: | MFCD08451109 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCC(Cc1ccc(cc1OC)OCCCC(=O)O)N |
InChi: | InChI=1S/C15H23NO4/c1-3-12(16)9-11-6-7-13(10-14(11)19-2)20-8-4-5-15(17)18/h6-7,10,12H,3-5,8-9,16H2,1-2H3,(H,17,18) |
InChiKey: | InChIKey=GPJJGEDZFIMEKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.