* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AN KB 0718 |
English Synonyms: | RARECHEM AN KB 0718 |
MDL Number.: | MFCD08451116 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(Cc1ccc(s1)c2ccccc2)N |
InChi: | InChI=1S/C14H17NS/c1-2-12(15)10-13-8-9-14(16-13)11-6-4-3-5-7-11/h3-9,12H,2,10,15H2,1H3 |
InChiKey: | InChIKey=NWIVEUZCJMPOOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.