* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AN KB 1210 |
| English Synonyms: | RARECHEM AN KB 1210 |
| MDL Number.: | MFCD08451522 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(Cc1nc(cs1)C)N.Cl |
| InChi: | InChI=1S/C8H14N2S.ClH/c1-3-7(9)4-8-10-6(2)5-11-8;/h5,7H,3-4,9H2,1-2H3;1H |
| InChiKey: | InChIKey=SKTHPKYGWYUQHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.