* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AN KC 1493 |
| English Synonyms: | RARECHEM AN KC 1493 |
| MDL Number.: | MFCD08453739 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(CC1(CCOCC1)c2cccc(c2)C(F)(F)F)N |
| InChi: | InChI=1S/C15H20F3NO/c1-11(19)10-14(5-7-20-8-6-14)12-3-2-4-13(9-12)15(16,17)18/h2-4,9,11H,5-8,10,19H2,1H3 |
| InChiKey: | InChIKey=ZBKIGXRLSPJLAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.