* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 1697 |
| EnglishSynonyms: | RARECHEM AN KC 1697 |
| pro_mdlNumber: | MFCD08453914 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | Cc1cc(c(n1c2cccc(c2C)C(=O)O)C)CC(C)N |
| InChi: | InChI=1S/C17H22N2O2/c1-10(18)8-14-9-11(2)19(13(14)4)16-7-5-6-15(12(16)3)17(20)21/h5-7,9-10H,8,18H2,1-4H3,(H,20,21) |
| InChiKey: | InChIKey=AMZCBQMWYAAVCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.