* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AN KC 2201 |
| English Synonyms: | RARECHEM AN KC 2201 |
| MDL Number.: | MFCD08454411 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(Cc1cc(ccc1N2CCN(CC2)Cc3ccccc3)F)N |
| InChi: | InChI=1S/C20H26FN3/c1-16(22)13-18-14-19(21)7-8-20(18)24-11-9-23(10-12-24)15-17-5-3-2-4-6-17/h2-8,14,16H,9-13,15,22H2,1H3 |
| InChiKey: | InChIKey=ZJEGWPBHFJTMFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.