* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AN KD 0023 |
| English Synonyms: | RARECHEM AN KD 0023 |
| MDL Number.: | MFCD08454591 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1CC(CO)N)c2cc(cc(c2)Cl)Cl.Cl |
| InChi: | InChI=1S/C15H15Cl2NO.ClH/c16-13-6-12(7-14(17)8-13)11-3-1-10(2-4-11)5-15(18)9-19;/h1-4,6-8,15,19H,5,9,18H2;1H |
| InChiKey: | InChIKey=BQUIVVZLOPAFBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.