* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0054 |
| EnglishSynonyms: | RARECHEM AN KD 0054 |
| pro_mdlNumber: | MFCD08454610 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | c1cc(ccc1CC(CO)N)c2ccc(cc2)CC(=O)O.Cl |
| InChi: | InChI=1S/C17H19NO3.ClH/c18-16(11-19)9-12-1-5-14(6-2-12)15-7-3-13(4-8-15)10-17(20)21;/h1-8,16,19H,9-11,18H2,(H,20,21);1H |
| InChiKey: | InChIKey=NFXHDMGKLQTBKC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.