* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0064 |
| EnglishSynonyms: | RARECHEM AN KD 0064 |
| pro_mdlNumber: | MFCD08454618 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(c(c1)CC(CO)N)Br.Cl |
| InChi: | InChI=1S/C9H12BrNO.ClH/c10-9-4-2-1-3-7(9)5-8(11)6-12;/h1-4,8,12H,5-6,11H2;1H |
| InChiKey: | InChIKey=FGFQITQLZULMRF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.