* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0079 |
| EnglishSynonyms: | RARECHEM AN KD 0079 |
| pro_mdlNumber: | MFCD08454632 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CCOc1ccccc1CC(CO)N.Cl |
| InChi: | InChI=1S/C11H17NO2.ClH/c1-2-14-11-6-4-3-5-9(11)7-10(12)8-13;/h3-6,10,13H,2,7-8,12H2,1H3;1H |
| InChiKey: | InChIKey=FRNDEUCXWGZUHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.