* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0890 |
| EnglishSynonyms: | RARECHEM AN KD 0890 |
| pro_mdlNumber: | MFCD08455313 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | Cc1cc(n(n1)C)CC(CO)N.Cl |
| InChi: | InChI=1S/C8H15N3O.ClH/c1-6-3-8(11(2)10-6)4-7(9)5-12;/h3,7,12H,4-5,9H2,1-2H3;1H |
| InChiKey: | InChIKey=NGVZDRNHVCVULO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.