* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 1046 |
| EnglishSynonyms: | RARECHEM AX KI 1046 |
| pro_mdlNumber: | MFCD08456679 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)NCCC(c4ccc(c(c4)Cl)Cl)C(=O)O |
| InChi: | InChI=1S/C25H21Cl2NO4/c26-22-10-9-15(13-23(22)27)16(24(29)30)11-12-28-25(31)32-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,13,16,21H,11-12,14H2,(H,28,31)(H,29,30) |
| InChiKey: | InChIKey=UYYAFDWACBIKHG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.