* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM BW GA 0367 |
English Synonyms: | RARECHEM BW GA 0367 |
MDL Number.: | MFCD08456739 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)C(=O)/C=C/c2cccc(c2)S(=O)(=O)[O-])O.[K+] |
InChi: | InChI=1S/C15H12O5S.K/c16-14-7-2-1-6-13(14)15(17)9-8-11-4-3-5-12(10-11)21(18,19)20;/h1-10,16H,(H,18,19,20);/q;+1/p-1/b9-8+; |
InChiKey: | InChIKey=JZWBXUHVSGSEBE-HRNDJLQDSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.