* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-2,3,4,4A,5,9B-HEXAHYDRO-1H-PYRIDO[4,3-B]INDOLE |
| CAS: | 885272-54-8 ;954239-28-2 |
| English Synonyms: | 8-CHLORO-1H,2H,3H,4H,4AH,5H,9BH-PYRIDO[4,3-B]INDOLE ; 8-CHLORO-2,3,4,4A,5,9B-HEXAHYDRO-1H-PYRIDO[4,3-B]INDOLE |
| MDL Number.: | MFCD08457630 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1Cl)C3CNCCC3N2 |
| InChi: | InChI=1S/C11H13ClN2/c12-7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-2,5,9,11,13-14H,3-4,6H2 |
| InChiKey: | InChIKey=CTRPRBJZXMYEJI-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.