* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOQUINODIN A |
| English Synonyms: | XANTHOQUINODIN A |
| MDL Number.: | MFCD08457947 |
| H bond acceptor: | 11 |
| H bond donor: | 5 |
| Smile: | Cc1cc2c(c(c1)O)C(=C3C(=O)[C@H]4C=C[C@]3(C2=O)Cc5c4c(c6c(c5)O[C@]7([C@H](CCC(=C7C6=O)O)O)C(=O)OC)O)O.Cc1cc2c(c(c1)O)C(=C3C(=O)[C@H]4C=C[C@]3(C2=O)Cc5c4c(c6c(c5)O[C@@]7([C@H](CCC(=C7C6=O)O)O)C(=O)OC)O)O |
| InChi: | InChI=1S/2C31H24O11/c2*1-11-7-14-20(16(33)8-11)26(37)23-24(35)13-5-6-30(23,28(14)39)10-12-9-17-21(25(36)19(12)13)27(38)22-15(32)3-4-18(34)31(22,42-17)29(40)41-2/h2*5-9,13,18,32-34,36-37H,3-4,10H2,1-2H3/t13-,18-,30-,31+;13-,18-,30-,31-/m00/s1 |
| InChiKey: | InChIKey=SKDGUQSWWKGPMS-ZEKHFBOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.