* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,5-DIBROMO-2-IODOPYRIDINE |
| CAS: | 436799-34-7 |
| English Synonyms: | 3,5-DIBROMO-2-IODOPYRIDINE |
| MDL Number.: | MFCD08543470 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1c(cnc(c1Br)I)Br |
| InChi: | InChI=1S/C5H2Br2IN/c6-3-1-4(7)5(8)9-2-3/h1-2H |
| InChiKey: | InChIKey=PZQKNKIWCXCOCY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.