* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB015798 |
| English Synonyms: | VITAS-BB TBB015798 |
| MDL Number.: | MFCD08559067 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCN1C=C(C(=O)NCCNC(=O)C2=CN(CC)N=C2C)C(C)=N1 |
| InChi: | InChI=1S/C16H24N6O2/c1-5-21-9-13(11(3)19-21)15(23)17-7-8-18-16(24)14-10-22(6-2)20-12(14)4/h9-10H,5-8H2,1-4H3,(H,17,23)(H,18,24) |
| InChiKey: | InChIKey=KLGFARBFXHQQTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.