* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(3-AMINO-PROPYL)-1H-IMIDAZOL-2-YLAMINE 2HCL |
| CAS: | 80822-62-4 |
| English Synonyms: | 4-(3-AMINO-PROPYL)-1H-IMIDAZOL-2-YLAMINE 2HCL |
| MDL Number.: | MFCD08668254 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1c(nc([nH]1)N)CCCN.Cl.Cl |
| InChi: | InChI=1S/C6H12N4.2ClH/c7-3-1-2-5-4-9-6(8)10-5;;/h4H,1-3,7H2,(H3,8,9,10);2*1H |
| InChiKey: | InChIKey=OKYOEXLKAFAKIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.