* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3-BUTYRYL-1H-INDOL-1-YL)ACETIC ACID |
CAS: | 892676-98-1 |
English Synonyms: | (3-BUTYRYL-1H-INDOL-1-YL)ACETIC ACID |
MDL Number.: | MFCD08676634 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCC(=O)c1cn(c2c1cccc2)CC(=O)O |
InChi: | InChI=1S/C14H15NO3/c1-2-5-13(16)11-8-15(9-14(17)18)12-7-4-3-6-10(11)12/h3-4,6-8H,2,5,9H2,1H3,(H,17,18) |
InChiKey: | InChIKey=MWJZDOGFNNCVNW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.