* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (6S)-6-METHYL-2-PIPERIDINONE |
CAS: | 1558-58-3 |
English Synonyms: | (6S)-6-METHYL-2-PIPERIDINONE ; (S)-6-METHYLPIPERAZIN-2-ONE |
MDL Number.: | MFCD08689602 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@H]1CCCC(=O)N1 |
InChi: | InChI=1S/C6H11NO/c1-5-3-2-4-6(8)7-5/h5H,2-4H2,1H3,(H,7,8)/t5-/m0/s1 |
InChiKey: | InChIKey=XPMMAKUHNMSONL-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.