* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JNJ 16259685 |
| CAS: | 409345-29-5 |
| English Synonyms: | (3,4-DIHYDRO-2H-PYRANO[2,3-B]QUINOLIN-7-YL)-(CIS-4-METHOXYCYCLOHEXYL)-METHANONE ; JNJ 16259685 |
| MDL Number.: | MFCD08690525 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CO[C@H]1CC[C@H](CC1)C(=O)c2ccc3c(c2)cc4c(n3)OCCC4 |
| InChi: | InChI=1S/C20H23NO3/c1-23-17-7-4-13(5-8-17)19(22)14-6-9-18-16(11-14)12-15-3-2-10-24-20(15)21-18/h6,9,11-13,17H,2-5,7-8,10H2,1H3/t13-,17+ |
| InChiKey: | InChIKey=QOTAQTRFJWLFCR-XFHMXUHZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.