* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SARIZOTAN |
| CAS: | 177975-08-5 |
| English Synonyms: | SARIZOTAN |
| MDL Number.: | MFCD08690573 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)CC[C@@H](O2)CNCc3cc(cnc3)c4ccc(cc4)F |
| InChi: | InChI=1S/C22H21FN2O/c23-20-8-5-17(6-9-20)19-11-16(12-24-14-19)13-25-15-21-10-7-18-3-1-2-4-22(18)26-21/h1-6,8-9,11-12,14,21,25H,7,10,13,15H2/t21-/m1/s1 |
| InChiKey: | InChIKey=HKFMQJUJWSFOLY-OAQYLSRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.